C16H25N3O3 — CID 108867823
3-(2,6-dimethoxyphenyl)-1-methyl-1-(1-methylpiperidin-4-yl)urea (PubChem CID 108867823) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-(2,6-dimethoxyphenyl)-1-methyl-1-(1-methylpiperidin-4-yl)urea.
| Compound Name | 3-(2,6-dimethoxyphenyl)-1-methyl-1-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 108867823 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3-(2,6-dimethoxyphenyl)-1-methyl-1-(1-methylpiperidin-4-yl)urea |
| SMILES | COc1cccc(OC)c1NC(=O)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-18-10-8-12(9-11-18)19(2)16(20)17-15-13(21-3)6-5-7-14(15)22-4/h5-7,12H,8-11H2,1-4H3,(H,17,20) |
| InChIKey | OAKGYGHBXVAXSI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |