C18H17NO3 — CID 1088695
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylbenzoate (PubChem CID 1088695) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylbenzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 1088695 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17NO3/c1-13-6-8-15(9-7-13)18(21)22-12-17(20)19-11-10-14-4-2-3-5-16(14)19/h2-9H,10-12H2,1H3 |
| InChIKey | JAPHILDOUQLDEU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |