C21H25N3O4 — CID 108875635
1-(3,4-dimethoxyphenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea (PubChem CID 108875635) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 108875635 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea |
| SMILES | COc1ccc(NC(=O)NC2CC(=O)N(C(C)c3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C21H25N3O4/c1-14(15-7-5-4-6-8-15)24-13-17(12-20(24)25)23-21(26)22-16-9-10-18(27-2)19(11-16)28-3/h4-11,14,17H,12-13H2,1-3H3,(H2,22,23,26) |
| InChIKey | IHFAJLZLCQNSIT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |