C19H19Cl2N3O2 — CID 108875924
1-(2,6-dichlorophenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea (PubChem CID 108875924) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 108875924 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]urea |
| SMILES | CC(c1ccccc1)N1CC(NC(=O)Nc2c(Cl)cccc2Cl)CC1=O |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-12(13-6-3-2-4-7-13)24-11-14(10-17(24)25)22-19(26)23-18-15(20)8-5-9-16(18)21/h2-9,12,14H,10-11H2,1H3,(H2,22,23,26) |
| InChIKey | JNWAILZVFQEPHR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |