C24H30N4O3 — CID 108875887
4-(2-methoxyphenyl)-N-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]piperazine-1-carboxamide (PubChem CID 108875887) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]piperazine-1-carboxamide.
| Compound Name | 4-(2-methoxyphenyl)-N-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108875887 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]piperazine-1-carboxamide |
| SMILES | COc1ccccc1N1CCN(C(=O)NC2CC(=O)N(C(C)c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-18(19-8-4-3-5-9-19)28-17-20(16-23(28)29)25-24(30)27-14-12-26(13-15-27)21-10-6-7-11-22(21)31-2/h3-11,18,20H,12-17H2,1-2H3,(H,25,30) |
| InChIKey | YYXMADSELPGYRQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |