C15H19Cl2N3O2 — CID 108876025
1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 108876025) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108876025 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | CC(C)(C)N1CC(NC(=O)Nc2ccc(Cl)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-15(2,3)20-8-10(7-13(20)21)19-14(22)18-9-4-5-11(16)12(17)6-9/h4-6,10H,7-8H2,1-3H3,(H2,18,19,22) |
| InChIKey | CXYHGDZCBJQVHQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |