C15H21ClN4O2 — CID 108876118
1-(4-amino-3-chlorophenyl)-3-(1-tert-butyl-5-oxopyrrolidin-3-yl)urea (PubChem CID 108876118) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-3-(1-tert-butyl-5-oxopyrrolidin-3-yl)urea.
| Compound Name | 1-(4-amino-3-chlorophenyl)-3-(1-tert-butyl-5-oxopyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 108876118 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-3-(1-tert-butyl-5-oxopyrrolidin-3-yl)urea |
| SMILES | CC(C)(C)N1CC(NC(=O)Nc2ccc(N)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C15H21ClN4O2/c1-15(2,3)20-8-10(7-13(20)21)19-14(22)18-9-4-5-12(17)11(16)6-9/h4-6,10H,7-8,17H2,1-3H3,(H2,18,19,22) |
| InChIKey | GQJBPZCTUJYPKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|