C15H27N3O4 — CID 108876082
2-[(1-tert-butyl-5-oxopyrrolidin-3-yl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 108876082) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[(1-tert-butyl-5-oxopyrrolidin-3-yl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(1-tert-butyl-5-oxopyrrolidin-3-yl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108876082 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-[(1-tert-butyl-5-oxopyrrolidin-3-yl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)NC1CC(=O)N(C(C)(C)C)C1)C(=O)O |
| InChI | InChI=1S/C15H27N3O4/c1-9(2)6-11(13(20)21)17-14(22)16-10-7-12(19)18(8-10)15(3,4)5/h9-11H,6-8H2,1-5H3,(H,20,21)(H2,16,17,22) |
| InChIKey | REAHKFJVTWLAFK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |