C11H20ClN3O2 — CID 108876104
1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(2-chloroethyl)urea (PubChem CID 108876104) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(2-chloroethyl)urea.
| Compound Name | 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(2-chloroethyl)urea |
|---|---|
| PubChem CID | 108876104 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-(1-tert-butyl-5-oxopyrrolidin-3-yl)-3-(2-chloroethyl)urea |
| SMILES | CC(C)(C)N1CC(NC(=O)NCCCl)CC1=O |
| InChI | InChI=1S/C11H20ClN3O2/c1-11(2,3)15-7-8(6-9(15)16)14-10(17)13-5-4-12/h8H,4-7H2,1-3H3,(H2,13,14,17) |
| InChIKey | JPXRICCVYLYTHP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|