C10H18ClN3O2 — CID 108876829
1-(2-chloroethyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea (PubChem CID 108876829) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(2-chloroethyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 108876829 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
| SMILES | CC(C)N1CC(NC(=O)NCCCl)CC1=O |
| InChI | InChI=1S/C10H18ClN3O2/c1-7(2)14-6-8(5-9(14)15)13-10(16)12-4-3-11/h7-8H,3-6H2,1-2H3,(H2,12,13,16) |
| InChIKey | YMFODOQQZIXWQA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|