C14H17Cl2N3O2 — CID 108876978
1-(3,5-dichlorophenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea (PubChem CID 108876978) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 108876978 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
| SMILES | CC(C)N1CC(NC(=O)Nc2cc(Cl)cc(Cl)c2)CC1=O |
| InChI | InChI=1S/C14H17Cl2N3O2/c1-8(2)19-7-12(6-13(19)20)18-14(21)17-11-4-9(15)3-10(16)5-11/h3-5,8,12H,6-7H2,1-2H3,(H2,17,18,21) |
| InChIKey | IXQFXRBXDZFQBJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |