C15H20BrN3O2 — CID 108877024
1-(2-bromo-4-methylphenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea (PubChem CID 108877024) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 108877024 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-(5-oxo-1-propan-2-ylpyrrolidin-3-yl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CC(=O)N(C(C)C)C2)c(Br)c1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-9(2)19-8-11(7-14(19)20)17-15(21)18-13-5-4-10(3)6-12(13)16/h4-6,9,11H,7-8H2,1-3H3,(H2,17,18,21) |
| InChIKey | VUHDFWGCKXZPTJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |