C19H22F2N2O2 — CID 108877630
1-[(2-tert-butyl-4-methylphenoxy)methyl]-3-(2,6-difluorophenyl)urea (PubChem CID 108877630) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[(2-tert-butyl-4-methylphenoxy)methyl]-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-[(2-tert-butyl-4-methylphenoxy)methyl]-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 108877630 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(2-tert-butyl-4-methylphenoxy)methyl]-3-(2,6-difluorophenyl)urea |
| SMILES | Cc1ccc(OCNC(=O)Nc2c(F)cccc2F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-12-8-9-16(13(10-12)19(2,3)4)25-11-22-18(24)23-17-14(20)6-5-7-15(17)21/h5-10H,11H2,1-4H3,(H2,22,23,24) |
| InChIKey | FYPDJAQEVBGWCY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|