C19H30N2O4 — CID 108877547
6-[(2-tert-butyl-4-methylphenoxy)methylcarbamoylamino]hexanoic acid (PubChem CID 108877547) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 6-[(2-tert-butyl-4-methylphenoxy)methylcarbamoylamino]hexanoic acid.
| Compound Name | 6-[(2-tert-butyl-4-methylphenoxy)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 108877547 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 6-[(2-tert-butyl-4-methylphenoxy)methylcarbamoylamino]hexanoic acid |
| SMILES | Cc1ccc(OCNC(=O)NCCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-14-9-10-16(15(12-14)19(2,3)4)25-13-21-18(24)20-11-7-5-6-8-17(22)23/h9-10,12H,5-8,11,13H2,1-4H3,(H,22,23)(H2,20,21,24) |
| InChIKey | HYBBWWRTBGOXJX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|