C20H34N2O3 — CID 108877525
1-(3-butoxypropyl)-3-[(2-tert-butyl-4-methylphenoxy)methyl]urea (PubChem CID 108877525) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[(2-tert-butyl-4-methylphenoxy)methyl]urea.
| Compound Name | 1-(3-butoxypropyl)-3-[(2-tert-butyl-4-methylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108877525 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[(2-tert-butyl-4-methylphenoxy)methyl]urea |
| SMILES | CCCCOCCCNC(=O)NCOc1ccc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H34N2O3/c1-6-7-12-24-13-8-11-21-19(23)22-15-25-18-10-9-16(2)14-17(18)20(3,4)5/h9-10,14H,6-8,11-13,15H2,1-5H3,(H2,21,22,23) |
| InChIKey | VUARXPZICJOABP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|