C19H23IN2O2 — CID 108878706
1-(4-iodo-2-methylphenyl)-3-[1-(2-propan-2-ylphenoxy)ethyl]urea (PubChem CID 108878706) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-(4-iodo-2-methylphenyl)-3-[1-(2-propan-2-ylphenoxy)ethyl]urea.
| Compound Name | 1-(4-iodo-2-methylphenyl)-3-[1-(2-propan-2-ylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 108878706 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-(4-iodo-2-methylphenyl)-3-[1-(2-propan-2-ylphenoxy)ethyl]urea |
| SMILES | Cc1cc(I)ccc1NC(=O)NC(C)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C19H23IN2O2/c1-12(2)16-7-5-6-8-18(16)24-14(4)21-19(23)22-17-10-9-15(20)11-13(17)3/h5-12,14H,1-4H3,(H2,21,22,23) |
| InChIKey | MFDAWBSEBOPTDQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|