C19H23IN2O3S — CID 30268575
N-(4-iodo-2-methylphenyl)-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide (PubChem CID 30268575) has the molecular formula C19H23IN2O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide |
|---|---|
| PubChem CID | 30268575 |
| Molecular Formula | C19H23IN2O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-(N-methylsulfonyl-2-propan-2-ylanilino)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN(c1ccccc1C(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C19H23IN2O3S/c1-13(2)16-7-5-6-8-18(16)22(26(4,24)25)12-19(23)21-17-10-9-15(20)11-14(17)3/h5-11,13H,12H2,1-4H3,(H,21,23) |
| InChIKey | HACZMWPSUAIZIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|