C20H19IN2O3S — CID 3554676
N-(4-iodo-2-methylphenyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide (PubChem CID 3554676) has the molecular formula C20H19IN2O3S and a molecular weight of 494.35 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 3554676 |
| Molecular Formula | C20H19IN2O3S |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[methylsulfonyl(naphthalen-1-yl)amino]acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CN(c1cccc2ccccc12)S(C)(=O)=O |
| InChI | InChI=1S/C20H19IN2O3S/c1-14-12-16(21)10-11-18(14)22-20(24)13-23(27(2,25)26)19-9-5-7-15-6-3-4-8-17(15)19/h3-12H,13H2,1-2H3,(H,22,24) |
| InChIKey | SJPKYEKXNYFGGF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|