C15H22N2O4S — CID 108879043
2-[(3,4-dimethylphenoxy)methylcarbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108879043) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenoxy)methylcarbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(3,4-dimethylphenoxy)methylcarbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108879043 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[(3,4-dimethylphenoxy)methylcarbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)NCOc1ccc(C)c(C)c1)C(=O)O |
| InChI | InChI=1S/C15H22N2O4S/c1-10-4-5-12(8-11(10)2)21-9-16-15(20)17-13(14(18)19)6-7-22-3/h4-5,8,13H,6-7,9H2,1-3H3,(H,18,19)(H2,16,17,20) |
| InChIKey | UEVMCZTVGLFYDQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|