C16H24N2O4S — CID 108883764
2-[3-(2-methylphenoxy)propylcarbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108883764) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-[3-(2-methylphenoxy)propylcarbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[3-(2-methylphenoxy)propylcarbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108883764 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-[3-(2-methylphenoxy)propylcarbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)NCCCOc1ccccc1C)C(=O)O |
| InChI | InChI=1S/C16H24N2O4S/c1-12-6-3-4-7-14(12)22-10-5-9-17-16(21)18-13(15(19)20)8-11-23-2/h3-4,6-7,13H,5,8-11H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | SFDMZAXEUOQQIA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|