C18H18ClF3N2O2 — CID 108880195
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea (PubChem CID 108880195) has the molecular formula C18H18ClF3N2O2 and a molecular weight of 386.80 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880195 |
| Molecular Formula | C18H18ClF3N2O2 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[(2,3,6-trimethylphenoxy)methyl]urea |
| SMILES | Cc1ccc(C)c(OCNC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C18H18ClF3N2O2/c1-10-4-5-11(2)16(12(10)3)26-9-23-17(25)24-13-6-7-15(19)14(8-13)18(20,21)22/h4-8H,9H2,1-3H3,(H2,23,24,25) |
| InChIKey | LOCWIFNALPSSJI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|