C17H21N3O — CID 108884929
1-(4-tert-butylphenyl)-3-(5-methyl-2-pyridinyl)urea (PubChem CID 108884929) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(5-methyl-2-pyridinyl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(5-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 108884929 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(5-methyl-2-pyridinyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C(C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C17H21N3O/c1-12-5-10-15(18-11-12)20-16(21)19-14-8-6-13(7-9-14)17(2,3)4/h5-11H,1-4H3,(H2,18,19,20,21) |
| InChIKey | YLIGWNSJVUHTLZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |