C13H9F3IN3O — CID 1471569
1-(5-iodo-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 1471569) has the molecular formula C13H9F3IN3O and a molecular weight of 407.13 g/mol. Its IUPAC name is 1-(5-iodo-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-iodo-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 1471569 |
| Molecular Formula | C13H9F3IN3O |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 1-(5-iodo-2-pyridinyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)Nc1ccc(I)cn1 |
| InChI | InChI=1S/C13H9F3IN3O/c14-13(15,16)8-1-4-10(5-2-8)19-12(21)20-11-6-3-9(17)7-18-11/h1-7H,(H2,18,19,20,21) |
| InChIKey | AYMPQARHYWSVEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|