C9H12O4 — CID 10888602
(3aR,4S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 10888602) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3aR,4S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10888602 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3aR,4S,6aR)-4,5-bis(hydroxymethyl)-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2[C@H](C=C(CO)[C@H]2CO)O1 |
| InChI | InChI=1S/C9H12O4/c10-3-5-1-8-6(7(5)4-11)2-9(12)13-8/h1,6-8,10-11H,2-4H2/t6-,7-,8+/m1/s1 |
| InChIKey | SNZCOILRCAGWER-PRJMDXOYSA-N |
| XLogP | -0.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|