C12H18N2O2 — CID 108888781
1-butan-2-yl-3-(phenoxymethyl)urea (PubChem CID 108888781) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 1-butan-2-yl-3-(phenoxymethyl)urea.
| Compound Name | 1-butan-2-yl-3-(phenoxymethyl)urea |
|---|---|
| PubChem CID | 108888781 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-butan-2-yl-3-(phenoxymethyl)urea |
| SMILES | CCC(C)NC(=O)NCOc1ccccc1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-10(2)14-12(15)13-9-16-11-7-5-4-6-8-11/h4-8,10H,3,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | XEVHZBZNNAHWDU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|