C14H23N3O — CID 95147782
1-(3-anilinopropyl)-3-[(2R)-butan-2-yl]urea (PubChem CID 95147782) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-3-[(2R)-butan-2-yl]urea.
| Compound Name | 1-(3-anilinopropyl)-3-[(2R)-butan-2-yl]urea |
|---|---|
| PubChem CID | 95147782 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-(3-anilinopropyl)-3-[(2R)-butan-2-yl]urea |
| SMILES | CC[C@@H](C)NC(=O)NCCCNc1ccccc1 |
| InChI | InChI=1S/C14H23N3O/c1-3-12(2)17-14(18)16-11-7-10-15-13-8-5-4-6-9-13/h4-6,8-9,12,15H,3,7,10-11H2,1-2H3,(H2,16,17,18)/t12-/m1/s1 |
| InChIKey | PEESPVBHPIXWIL-GFCCVEGCSA-N |
| XLogP | 2.59 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|