C9H15N3O4 — CID 10889691
tert-butyl 3-(3,5-dioxo-1,2,4-triazolidin-4-yl)propanoate (PubChem CID 10889691) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is tert-butyl 3-(3,5-dioxo-1,2,4-triazolidin-4-yl)propanoate.
| Compound Name | tert-butyl 3-(3,5-dioxo-1,2,4-triazolidin-4-yl)propanoate |
|---|---|
| PubChem CID | 10889691 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | tert-butyl 3-(3,5-dioxo-1,2,4-triazolidin-4-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCn1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C9H15N3O4/c1-9(2,3)16-6(13)4-5-12-7(14)10-11-8(12)15/h4-5H2,1-3H3,(H,10,14)(H,11,15) |
| InChIKey | VTNDFTPPNZEFCC-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |