C13H20N2O4 — CID 116662713
tert-butyl 3-(3-ethyl-2,6-dioxopyrimidin-1-yl)propanoate (PubChem CID 116662713) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is tert-butyl 3-(3-ethyl-2,6-dioxopyrimidin-1-yl)propanoate.
| Compound Name | tert-butyl 3-(3-ethyl-2,6-dioxopyrimidin-1-yl)propanoate |
|---|---|
| PubChem CID | 116662713 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | tert-butyl 3-(3-ethyl-2,6-dioxopyrimidin-1-yl)propanoate |
| SMILES | CCn1ccc(=O)n(CCC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C13H20N2O4/c1-5-14-8-6-10(16)15(12(14)18)9-7-11(17)19-13(2,3)4/h6,8H,5,7,9H2,1-4H3 |
| InChIKey | AXAXCMHJOCFPGW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |