About 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione
1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione (PubChem CID 65097190) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione |
| PubChem CID | 65097190 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(CCCS(=O)(=O)CC)c1=O |
| InChI | InChI=1S/C11H18N2O4S/c1-3-12-8-6-10(14)13(11(12)15)7-5-9-18(16,17)4-2/h6,8H,3-5,7,9H2,1-2H3 |
| InChIKey | LTMIAPFZBVAIIE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione?
The IUPAC name of 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione (CID 65097190) is 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione?
The canonical SMILES for 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione is CCn1ccc(=O)n(CCCS(=O)(=O)CC)c1=O.
What is the InChIKey of 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione?
The InChIKey is LTMIAPFZBVAIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-3-12-8-6-10(14)13(11(12)15)7-5-9-18(16,17)4-2/h6,8H,3-5,7,9H2,1-2H3.
What are the key properties of 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione?
1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione has a molecular weight of 274.34 g/mol, XLogP of -0.15, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione is sourced from PubChem (CID 65097190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).