C11H18N2O4S — CID 65097190
1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione (PubChem CID 65097190) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 65097190 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-ethyl-3-(3-ethylsulfonylpropyl)pyrimidine-2,4-dione |
| SMILES | CCn1ccc(=O)n(CCCS(=O)(=O)CC)c1=O |
| InChI | InChI=1S/C11H18N2O4S/c1-3-12-8-6-10(14)13(11(12)15)7-5-9-18(16,17)4-2/h6,8H,3-5,7,9H2,1-2H3 |
| InChIKey | LTMIAPFZBVAIIE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |