C21H19ClN2OS — CID 108901388
1-[2-(3-chlorophenyl)ethyl]-3-(2-phenylsulfanylphenyl)urea (PubChem CID 108901388) has the molecular formula C21H19ClN2OS and a molecular weight of 382.92 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-(2-phenylsulfanylphenyl)urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2-phenylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 108901388 |
| Molecular Formula | C21H19ClN2OS |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2-phenylsulfanylphenyl)urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C21H19ClN2OS/c22-17-8-6-7-16(15-17)13-14-23-21(25)24-19-11-4-5-12-20(19)26-18-9-2-1-3-10-18/h1-12,15H,13-14H2,(H2,23,24,25) |
| InChIKey | ZHJOHWCHHXIMSP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |