C18H20BrN3O — CID 108905138
3-[(E)-2-(2-bromophenyl)ethenyl]-1-ethyl-1-(2-pyridin-4-ylethyl)urea (PubChem CID 108905138) has the molecular formula C18H20BrN3O and a molecular weight of 374.28 g/mol. Its IUPAC name is 3-[(E)-2-(2-bromophenyl)ethenyl]-1-ethyl-1-(2-pyridin-4-ylethyl)urea.
| Compound Name | 3-[(E)-2-(2-bromophenyl)ethenyl]-1-ethyl-1-(2-pyridin-4-ylethyl)urea |
|---|---|
| PubChem CID | 108905138 |
| Molecular Formula | C18H20BrN3O |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-[(E)-2-(2-bromophenyl)ethenyl]-1-ethyl-1-(2-pyridin-4-ylethyl)urea |
| SMILES | CCN(CCc1ccncc1)C(=O)N/C=C/c1ccccc1Br |
| InChI | InChI=1S/C18H20BrN3O/c1-2-22(14-10-15-7-11-20-12-8-15)18(23)21-13-9-16-5-3-4-6-17(16)19/h3-9,11-13H,2,10,14H2,1H3,(H,21,23)/b13-9+ |
| InChIKey | VZOXJLNGBHQQRH-UKTHLTGXSA-N |
| XLogP | 4.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |