C19H20FN3O2 — CID 108906258
1-[(E)-2-(3-fluorophenyl)ethenyl]-3-(2-morpholin-4-ylphenyl)urea (PubChem CID 108906258) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-[(E)-2-(3-fluorophenyl)ethenyl]-3-(2-morpholin-4-ylphenyl)urea.
| Compound Name | 1-[(E)-2-(3-fluorophenyl)ethenyl]-3-(2-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 108906258 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[(E)-2-(3-fluorophenyl)ethenyl]-3-(2-morpholin-4-ylphenyl)urea |
| SMILES | O=C(N/C=C/c1cccc(F)c1)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C19H20FN3O2/c20-16-5-3-4-15(14-16)8-9-21-19(24)22-17-6-1-2-7-18(17)23-10-12-25-13-11-23/h1-9,14H,10-13H2,(H2,21,22,24)/b9-8+ |
| InChIKey | CIHJZNKXNLJREG-CMDGGOBGSA-N |
| XLogP | 3.45 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |