C19H18Cl2N2O2 — CID 18227019
(E)-3-(3,4-dichlorophenyl)-N-(2-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 18227019) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(2-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(2-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18227019 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(2-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-15-7-5-14(13-16(15)21)6-8-19(24)22-17-3-1-2-4-18(17)23-9-11-25-12-10-23/h1-8,13H,9-12H2,(H,22,24)/b8-6+ |
| InChIKey | KEVCGFDAXBGBOE-SOFGYWHQSA-N |
| XLogP | 4.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|