C11H10F3NOS — CID 10890648
2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one (PubChem CID 10890648) has the molecular formula C11H10F3NOS and a molecular weight of 261.27 g/mol. Its IUPAC name is 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 10890648 |
| Molecular Formula | C11H10F3NOS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzothiazin-3-one |
| SMILES | CC1(C)Sc2ccc(C(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C11H10F3NOS/c1-10(2)9(16)15-7-5-6(11(12,13)14)3-4-8(7)17-10/h3-5H,1-2H3,(H,15,16) |
| InChIKey | OFCVHJABPZEDFW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |