C15H11F3N2OS — CID 86342435
7-[3-(trifluoromethyl)anilino]-4H-1,4-benzothiazin-3-one (PubChem CID 86342435) has the molecular formula C15H11F3N2OS and a molecular weight of 324.33 g/mol. Its IUPAC name is 7-[3-(trifluoromethyl)anilino]-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-[3-(trifluoromethyl)anilino]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 86342435 |
| Molecular Formula | C15H11F3N2OS |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 7-[3-(trifluoromethyl)anilino]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2cc(Nc3cccc(C(F)(F)F)c3)ccc2N1 |
| InChI | InChI=1S/C15H11F3N2OS/c16-15(17,18)9-2-1-3-10(6-9)19-11-4-5-12-13(7-11)22-8-14(21)20-12/h1-7,19H,8H2,(H,20,21) |
| InChIKey | ZVRAARQTTFEQRR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |