C20H24N2O — CID 108911309
1-benzhydryl-3-[(E)-3,3-dimethylbut-1-enyl]urea (PubChem CID 108911309) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-benzhydryl-3-[(E)-3,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-benzhydryl-3-[(E)-3,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911309 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-benzhydryl-3-[(E)-3,3-dimethylbut-1-enyl]urea |
| SMILES | CC(C)(C)/C=C/NC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O/c1-20(2,3)14-15-21-19(23)22-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15,18H,1-3H3,(H2,21,22,23)/b15-14+ |
| InChIKey | LFZDUFDPKPSSNZ-CCEZHUSRSA-N |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |