C15H21FN2O — CID 108911582
1-[(E)-3,3-dimethylbut-1-enyl]-3-[2-(2-fluorophenyl)ethyl]urea (PubChem CID 108911582) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-[(E)-3,3-dimethylbut-1-enyl]-3-[2-(2-fluorophenyl)ethyl]urea.
| Compound Name | 1-[(E)-3,3-dimethylbut-1-enyl]-3-[2-(2-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108911582 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-[(E)-3,3-dimethylbut-1-enyl]-3-[2-(2-fluorophenyl)ethyl]urea |
| SMILES | CC(C)(C)/C=C/NC(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C15H21FN2O/c1-15(2,3)9-11-18-14(19)17-10-8-12-6-4-5-7-13(12)16/h4-7,9,11H,8,10H2,1-3H3,(H2,17,18,19)/b11-9+ |
| InChIKey | RYMUYONUPNQPBX-PKNBQFBNSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |