C17H23FN2O — CID 108912333
1-[(E)-2-cyclohexylethenyl]-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 108912333) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-[(E)-2-cyclohexylethenyl]-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-[(E)-2-cyclohexylethenyl]-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108912333 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-[(E)-2-cyclohexylethenyl]-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | O=C(N/C=C/C1CCCCC1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN2O/c18-16-8-4-7-15(13-16)10-12-20-17(21)19-11-9-14-5-2-1-3-6-14/h4,7-9,11,13-14H,1-3,5-6,10,12H2,(H2,19,20,21)/b11-9+ |
| InChIKey | GOSRYARNPBBKBR-PKNBQFBNSA-N |
| XLogP | 3.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |