C16H22N2O3 — CID 108915719
1-[(E)-2-cyclopropylethenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea (PubChem CID 108915719) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[(E)-2-cyclopropylethenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-[(E)-2-cyclopropylethenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108915719 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-[(E)-2-cyclopropylethenyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)N/C=C/C2CC2)cc1OC |
| InChI | InChI=1S/C16H22N2O3/c1-20-14-6-5-13(11-15(14)21-2)8-10-18-16(19)17-9-7-12-3-4-12/h5-7,9,11-12H,3-4,8,10H2,1-2H3,(H2,17,18,19)/b9-7+ |
| InChIKey | QNAGVAWUPKHXHQ-VQHVLOKHSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |