C15H20N2O2 — CID 108913188
1-ethyl-3-(oxan-4-ylidenemethyl)-1-phenylurea (PubChem CID 108913188) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-ethyl-3-(oxan-4-ylidenemethyl)-1-phenylurea.
| Compound Name | 1-ethyl-3-(oxan-4-ylidenemethyl)-1-phenylurea |
|---|---|
| PubChem CID | 108913188 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-ethyl-3-(oxan-4-ylidenemethyl)-1-phenylurea |
| SMILES | CCN(C(=O)NC=C1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-2-17(14-6-4-3-5-7-14)15(18)16-12-13-8-10-19-11-9-13/h3-7,12H,2,8-11H2,1H3,(H,16,18) |
| InChIKey | OIXMMHZIEBOLAE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |