C17H25N3O — CID 108914026
1-[(E)-2-cyclopentylprop-1-enyl]-3-[3-(dimethylamino)phenyl]urea (PubChem CID 108914026) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-[(E)-2-cyclopentylprop-1-enyl]-3-[3-(dimethylamino)phenyl]urea.
| Compound Name | 1-[(E)-2-cyclopentylprop-1-enyl]-3-[3-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 108914026 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-[(E)-2-cyclopentylprop-1-enyl]-3-[3-(dimethylamino)phenyl]urea |
| SMILES | C/C(=C\NC(=O)Nc1cccc(N(C)C)c1)C1CCCC1 |
| InChI | InChI=1S/C17H25N3O/c1-13(14-7-4-5-8-14)12-18-17(21)19-15-9-6-10-16(11-15)20(2)3/h6,9-12,14H,4-5,7-8H2,1-3H3,(H2,18,19,21)/b13-12+ |
| InChIKey | MNJAYLNZMKYJHQ-OUKQBFOZSA-N |
| XLogP | 3.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |