C10H20N2O2 — CID 108914592
1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea (PubChem CID 108914592) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 108914592 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N/C=C(\C)C(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-8(2)9(3)7-12-10(13)11-5-6-14-4/h7-8H,5-6H2,1-4H3,(H2,11,12,13)/b9-7+ |
| InChIKey | YHHZHPRBMHYXHS-VQHVLOKHSA-N |
| XLogP | 1.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|