C16H24N2O2 — CID 108914630
1-[(E)-2,3-dimethylbut-1-enyl]-3-[1-(4-methoxyphenyl)ethyl]urea (PubChem CID 108914630) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(E)-2,3-dimethylbut-1-enyl]-3-[1-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-[1-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108914630 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-[1-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(C(C)NC(=O)N/C=C(\C)C(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O2/c1-11(2)12(3)10-17-16(19)18-13(4)14-6-8-15(20-5)9-7-14/h6-11,13H,1-5H3,(H2,17,18,19)/b12-10+ |
| InChIKey | BRMFGFIABPEXBB-ZRDIBKRKSA-N |
| XLogP | 3.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |