C17H35BO3 — CID 10891850
2-(1-butoxyheptan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 10891850) has the molecular formula C17H35BO3 and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-(1-butoxyheptan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1-butoxyheptan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10891850 |
| Molecular Formula | C17H35BO3 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 2-(1-butoxyheptan-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCOCCC(CCCC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H35BO3/c1-7-9-11-15(12-14-19-13-10-8-2)18-20-16(3,4)17(5,6)21-18/h15H,7-14H2,1-6H3 |
| InChIKey | DBOSYWVGQYFJHI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|