C18H37BO3 — CID 164681010
4,4,5,5-tetramethyl-2-[8-[(2-methylpropan-2-yl)oxy]octyl]-1,3,2-dioxaborolane (PubChem CID 164681010) has the molecular formula C18H37BO3 and a molecular weight of 312.30 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[8-[(2-methylpropan-2-yl)oxy]octyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[8-[(2-methylpropan-2-yl)oxy]octyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164681010 |
| Molecular Formula | C18H37BO3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[8-[(2-methylpropan-2-yl)oxy]octyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)OCCCCCCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H37BO3/c1-16(2,3)20-15-13-11-9-8-10-12-14-19-21-17(4,5)18(6,7)22-19/h8-15H2,1-7H3 |
| InChIKey | YIIMVERSGVFEEZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|