C27H35N3O4 — CID 108918958
tert-butyl N-[3-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-3-oxopropyl]carbamate (PubChem CID 108918958) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108918958 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | tert-butyl N-[3-[4-(2,2-diphenylacetyl)-1,4-diazepan-1-yl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N1CCCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H35N3O4/c1-27(2,3)34-26(33)28-16-15-23(31)29-17-10-18-30(20-19-29)25(32)24(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-9,11-14,24H,10,15-20H2,1-3H3,(H,28,33) |
| InChIKey | SRPCQKFZBMDBKK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |