About (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate
(4-oxocyclohexyl) 3-oxo-4-phenylhexanoate (PubChem CID 10891989) has the molecular formula C18H22O4
and a molecular weight of 302.37 g/mol. Its IUPAC name is (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate.
Molecular Properties
| Compound Name | (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate |
| PubChem CID | 10891989 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate |
| SMILES | CCC(C(=O)CC(=O)OC1CCC(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-2-16(13-6-4-3-5-7-13)17(20)12-18(21)22-15-10-8-14(19)9-11-15/h3-7,15-16H,2,8-12H2,1H3 |
| InChIKey | RAONAUPLVNHZGS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate?
The IUPAC name of (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate (CID 10891989) is (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate.
What is the SMILES notation for (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate?
The canonical SMILES for (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate is CCC(C(=O)CC(=O)OC1CCC(=O)CC1)c1ccccc1.
What is the InChIKey of (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate?
The InChIKey is RAONAUPLVNHZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4/c1-2-16(13-6-4-3-5-7-13)17(20)12-18(21)22-15-10-8-14(19)9-11-15/h3-7,15-16H,2,8-12H2,1H3.
What are the key properties of (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate?
(4-oxocyclohexyl) 3-oxo-4-phenylhexanoate has a molecular weight of 302.37 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexyl) 3-oxo-4-phenylhexanoate is sourced from PubChem (CID 10891989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).