C18H27N3O2 — CID 108922299
2-cyano-N-[[1-[(E)-3-cyclohexylprop-2-enoyl]piperidin-4-yl]methyl]acetamide (PubChem CID 108922299) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-cyano-N-[[1-[(E)-3-cyclohexylprop-2-enoyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | 2-cyano-N-[[1-[(E)-3-cyclohexylprop-2-enoyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 108922299 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2-cyano-N-[[1-[(E)-3-cyclohexylprop-2-enoyl]piperidin-4-yl]methyl]acetamide |
| SMILES | N#CCC(=O)NCC1CCN(C(=O)/C=C/C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c19-11-8-17(22)20-14-16-9-12-21(13-10-16)18(23)7-6-15-4-2-1-3-5-15/h6-7,15-16H,1-5,8-10,12-14H2,(H,20,22)/b7-6+ |
| InChIKey | YNXMROFAHAIIAW-VOTSOKGWSA-N |
| XLogP | 2.39 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|