C17H32O3Si — CID 10892352
(3S,3aS,4R,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one (PubChem CID 10892352) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is (3S,3aS,4R,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one.
| Compound Name | (3S,3aS,4R,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one |
|---|---|
| PubChem CID | 10892352 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (3S,3aS,4R,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one |
| SMILES | C[C@H]1CC[C@H]2[C@H]1[C@@H](O)C(=O)CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-11-7-8-12-14(20-21(5,6)17(2,3)4)10-9-13(18)16(19)15(11)12/h11-12,14-16,19H,7-10H2,1-6H3/t11-,12+,14-,15-,16-/m0/s1 |
| InChIKey | DHSZOAQQQGMQNG-URLPEUOOSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|