C21H40O3Si — CID 11451491
(3S,3aS,8R,8aS)-3-(1-hydroxyethyl)-8-tri(propan-2-yl)silyloxy-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one (PubChem CID 11451491) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (3S,3aS,8R,8aS)-3-(1-hydroxyethyl)-8-tri(propan-2-yl)silyloxy-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one.
| Compound Name | (3S,3aS,8R,8aS)-3-(1-hydroxyethyl)-8-tri(propan-2-yl)silyloxy-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one |
|---|---|
| PubChem CID | 11451491 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (3S,3aS,8R,8aS)-3-(1-hydroxyethyl)-8-tri(propan-2-yl)silyloxy-2,3,3a,4,6,7,8,8a-octahydro-1H-azulen-5-one |
| SMILES | CC(O)[C@H]1CC[C@H]2[C@H]1CC(=O)CC[C@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-13(2)25(14(3)4,15(5)6)24-21-11-8-17(23)12-20-18(16(7)22)9-10-19(20)21/h13-16,18-22H,8-12H2,1-7H3/t16?,18-,19+,20+,21-/m1/s1 |
| InChIKey | ZZTXBEXIELBGDP-NDSPWTRSSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|